C17H27BrN2O3S — CID 59250801
tert-butyl (3S)-3-(6-bromo-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]butanoate (PubChem CID 59250801) has the molecular formula C17H27BrN2O3S and a molecular weight of 419.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-(6-bromo-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]butanoate.
| Compound Name | tert-butyl (3S)-3-(6-bromo-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]butanoate |
|---|---|
| PubChem CID | 59250801 |
| Molecular Formula | C17H27BrN2O3S |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl (3S)-3-(6-bromo-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@](C)(N[S@](=O)C(C)(C)C)c1cccc(Br)n1 |
| InChI | InChI=1S/C17H27BrN2O3S/c1-15(2,3)23-14(21)11-17(7,20-24(22)16(4,5)6)12-9-8-10-13(18)19-12/h8-10,20H,11H2,1-7H3/t17-,24+/m0/s1 |
| InChIKey | ZVEWWXDUFYNDQZ-BXKMTCNYSA-N |
| XLogP | 3.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|