C12H17BrN2O2 — CID 177202082
tert-butyl N-[(1S)-1-(6-bromo-2-pyridinyl)ethyl]carbamate (PubChem CID 177202082) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(6-bromo-2-pyridinyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(6-bromo-2-pyridinyl)ethyl]carbamate |
|---|---|
| PubChem CID | 177202082 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | tert-butyl N-[(1S)-1-(6-bromo-2-pyridinyl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1cccc(Br)n1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-8(9-6-5-7-10(13)15-9)14-11(16)17-12(2,3)4/h5-8H,1-4H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | TZOGZPMIEZIKIR-QMMMGPOBSA-N |
| XLogP | 3.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|