C12H14BrF3N2O2 — CID 170577042
tert-butyl N-[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate (PubChem CID 170577042) has the molecular formula C12H14BrF3N2O2 and a molecular weight of 355.15 g/mol. Its IUPAC name is tert-butyl N-[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate.
| Compound Name | tert-butyl N-[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate |
|---|---|
| PubChem CID | 170577042 |
| Molecular Formula | C12H14BrF3N2O2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | tert-butyl N-[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cccc(Br)n1)C(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O2/c1-11(2,3)20-10(19)18-9(12(14,15)16)7-5-4-6-8(13)17-7/h4-6,9H,1-3H3,(H,18,19) |
| InChIKey | ZOTNZQFMXSKNEJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|