C15H20BrN3O4 — CID 58706929
tert-butyl N-[(2R)-1-[[2-(6-bromo-2-pyridinyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 58706929) has the molecular formula C15H20BrN3O4 and a molecular weight of 386.25 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[2-(6-bromo-2-pyridinyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[2-(6-bromo-2-pyridinyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58706929 |
| Molecular Formula | C15H20BrN3O4 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[2-(6-bromo-2-pyridinyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)c1cccc(Br)n1 |
| InChI | InChI=1S/C15H20BrN3O4/c1-9(18-14(22)23-15(2,3)4)13(21)17-8-11(20)10-6-5-7-12(16)19-10/h5-7,9H,8H2,1-4H3,(H,17,21)(H,18,22)/t9-/m1/s1 |
| InChIKey | SXSOMJMDXZITLW-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|