C17H24BrF3N2O3S — CID 86732172
tert-butyl (3S)-3-(6-bromo-3-fluoro-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]-4,4-difluorobutanoate (PubChem CID 86732172) has the molecular formula C17H24BrF3N2O3S and a molecular weight of 473.36 g/mol. Its IUPAC name is tert-butyl (3S)-3-(6-bromo-3-fluoro-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]-4,4-difluorobutanoate.
| Compound Name | tert-butyl (3S)-3-(6-bromo-3-fluoro-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 86732172 |
| Molecular Formula | C17H24BrF3N2O3S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | tert-butyl (3S)-3-(6-bromo-3-fluoro-2-pyridinyl)-3-[[(R)-tert-butylsulfinyl]amino]-4,4-difluorobutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@](N[S@](=O)C(C)(C)C)(c1nc(Br)ccc1F)C(F)F |
| InChI | InChI=1S/C17H24BrF3N2O3S/c1-15(2,3)26-12(24)9-17(14(20)21,23-27(25)16(4,5)6)13-10(19)7-8-11(18)22-13/h7-8,14,23H,9H2,1-6H3/t17-,27+/m0/s1 |
| InChIKey | UGMLQJGJAUIJBW-CBZJRKILSA-N |
| XLogP | 4.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|