C18H30BrF3N2O2SSi — CID 141461732
(S)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 141461732) has the molecular formula C18H30BrF3N2O2SSi and a molecular weight of 503.50 g/mol. Its IUPAC name is (S)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 141461732 |
| Molecular Formula | C18H30BrF3N2O2SSi |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (S)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[Si](CC)(CC)c1cc(Br)nc([C@](CO)(N[S@@](=O)C(C)(C)C)C(F)F)c1F |
| InChI | InChI=1S/C18H30BrF3N2O2SSi/c1-7-28(8-2,9-3)12-10-13(19)23-15(14(12)20)18(11-25,16(21)22)24-27(26)17(4,5)6/h10,16,24-25H,7-9,11H2,1-6H3/t18-,27-/m0/s1 |
| InChIKey | NSUZSTGAUGDLNB-MYUZEXMDSA-N |
| XLogP | 4.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|