C17H28BrFN2OSSi — CID 140802799
(NZ,R)-N-[1-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 140802799) has the molecular formula C17H28BrFN2OSSi and a molecular weight of 435.48 g/mol. Its IUPAC name is (NZ,R)-N-[1-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[1-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140802799 |
| Molecular Formula | C17H28BrFN2OSSi |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (NZ,R)-N-[1-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC[Si](CC)(CC)c1cc(Br)nc(/C(C)=N\[S@](=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C17H28BrFN2OSSi/c1-8-24(9-2,10-3)13-11-14(18)20-16(15(13)19)12(4)21-23(22)17(5,6)7/h11H,8-10H2,1-7H3/b21-12-/t23-/m1/s1 |
| InChIKey | JHOAOIMCFCLDTO-VVOOWDFBSA-N |
| XLogP | 4.97 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|