C10H13BrFNOS2 — CID 123908069
N-[1-(5-bromo-3-fluorothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 123908069) has the molecular formula C10H13BrFNOS2 and a molecular weight of 326.26 g/mol. Its IUPAC name is N-[1-(5-bromo-3-fluorothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(5-bromo-3-fluorothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123908069 |
| Molecular Formula | C10H13BrFNOS2 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-[1-(5-bromo-3-fluorothiophen-2-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=NS(=O)C(C)(C)C)c1sc(Br)cc1F |
| InChI | InChI=1S/C10H13BrFNOS2/c1-6(13-16(14)10(2,3)4)9-7(12)5-8(11)15-9/h5H,1-4H3 |
| InChIKey | XCEFSXIAHDKCCV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|