C12H14BrF2NOS — CID 86715733
N-[1-(3-bromo-2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86715733) has the molecular formula C12H14BrF2NOS and a molecular weight of 338.22 g/mol. Its IUPAC name is N-[1-(3-bromo-2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(3-bromo-2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86715733 |
| Molecular Formula | C12H14BrF2NOS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | N-[1-(3-bromo-2,6-difluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=NS(=O)C(C)(C)C)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H14BrF2NOS/c1-7(16-18(17)12(2,3)4)10-9(14)6-5-8(13)11(10)15/h5-6H,1-4H3 |
| InChIKey | LUDWWHPIKDUGLL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|