C12H17FN2OS — CID 152664377
(R)-N-[1-(3-amino-2-fluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 152664377) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is (R)-N-[1-(3-amino-2-fluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(3-amino-2-fluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 152664377 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (R)-N-[1-(3-amino-2-fluorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=N[S@](=O)C(C)(C)C)c1cccc(N)c1F |
| InChI | InChI=1S/C12H17FN2OS/c1-8(15-17(16)12(2,3)4)9-6-5-7-10(14)11(9)13/h5-7H,14H2,1-4H3/t17-/m1/s1 |
| InChIKey | ZKEWXTUMLBZPGQ-QGZVFWFLSA-N |
| XLogP | 2.68 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|