C13H15FN2OS — CID 172536203
(NZ,R)-N-[1-(2-fluoro-3-isocyanophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172536203) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is (NZ,R)-N-[1-(2-fluoro-3-isocyanophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[1-(2-fluoro-3-isocyanophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172536203 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (NZ,R)-N-[1-(2-fluoro-3-isocyanophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | [C-]#[N+]c1cccc(/C(C)=N\[S@](=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C13H15FN2OS/c1-9(16-18(17)13(2,3)4)10-7-6-8-11(15-5)12(10)14/h6-8H,1-4H3/b16-9-/t18-/m1/s1 |
| InChIKey | WBFABFAJYOUYNK-YZIPPPLESA-N |
| XLogP | 3.65 |
| TPSA | 33.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|