C13H14BrClN2OS2 — CID 118424740
(NE,R)-N-[1-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118424740) has the molecular formula C13H14BrClN2OS2 and a molecular weight of 393.76 g/mol. Its IUPAC name is (NE,R)-N-[1-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118424740 |
| Molecular Formula | C13H14BrClN2OS2 |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | (NE,R)-N-[1-(7-bromo-3-chlorothieno[2,3-c]pyridin-2-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@](=O)C(C)(C)C)c1sc2c(Br)nccc2c1Cl |
| InChI | InChI=1S/C13H14BrClN2OS2/c1-7(17-20(18)13(2,3)4)10-9(15)8-5-6-16-12(14)11(8)19-10/h5-6H,1-4H3/b17-7+/t20-/m1/s1 |
| InChIKey | LFVFLJGMIRKIIW-KDRVJRGFSA-N |
| XLogP | 4.98 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|