C9H14N2OS2 — CID 123835998
(R)-2-methyl-N-[1-(1,3-thiazol-2-yl)ethylidene]propane-2-sulfinamide (PubChem CID 123835998) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (R)-2-methyl-N-[1-(1,3-thiazol-2-yl)ethylidene]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[1-(1,3-thiazol-2-yl)ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 123835998 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (R)-2-methyl-N-[1-(1,3-thiazol-2-yl)ethylidene]propane-2-sulfinamide |
| SMILES | CC(=N[S@](=O)C(C)(C)C)c1nccs1 |
| InChI | InChI=1S/C9H14N2OS2/c1-7(8-10-5-6-13-8)11-14(12)9(2,3)4/h5-6H,1-4H3/t14-/m1/s1 |
| InChIKey | PLLHWNJEOZWYCB-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|