C12H16N2O2S — CID 3830711
[1-(1,3-thiazol-2-yl)ethylideneamino] cyclohexanecarboxylate (PubChem CID 3830711) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is [1-(1,3-thiazol-2-yl)ethylideneamino] cyclohexanecarboxylate.
| Compound Name | [1-(1,3-thiazol-2-yl)ethylideneamino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 3830711 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | [1-(1,3-thiazol-2-yl)ethylideneamino] cyclohexanecarboxylate |
| SMILES | CC(=NOC(=O)C1CCCCC1)c1nccs1 |
| InChI | InChI=1S/C12H16N2O2S/c1-9(11-13-7-8-17-11)14-16-12(15)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 |
| InChIKey | RRXZTDHBRAEGPA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|