C10H17N4OS+ — CID 156598389
trimethyl-[2-oxo-2-[(2E)-2-[1-(1,3-thiazol-2-yl)ethylidene]hydrazinyl]ethyl]azanium (PubChem CID 156598389) has the molecular formula C10H17N4OS+ and a molecular weight of 241.34 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[(2E)-2-[1-(1,3-thiazol-2-yl)ethylidene]hydrazinyl]ethyl]azanium.
| Compound Name | trimethyl-[2-oxo-2-[(2E)-2-[1-(1,3-thiazol-2-yl)ethylidene]hydrazinyl]ethyl]azanium |
|---|---|
| PubChem CID | 156598389 |
| Molecular Formula | C10H17N4OS+ |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | trimethyl-[2-oxo-2-[(2E)-2-[1-(1,3-thiazol-2-yl)ethylidene]hydrazinyl]ethyl]azanium |
| SMILES | C/C(=N\NC(=O)C[N+](C)(C)C)c1nccs1 |
| InChI | InChI=1S/C10H16N4OS/c1-8(10-11-5-6-16-10)12-13-9(15)7-14(2,3)4/h5-6H,7H2,1-4H3/p+1 |
| InChIKey | YXBFZWYZYMNDGM-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|