C13H18N4O4S2 — CID 3693628
dimethyl 2-[[1-(1,3-thiazol-2-yl)ethylideneamino]carbamothioylamino]pentanedioate (PubChem CID 3693628) has the molecular formula C13H18N4O4S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is dimethyl 2-[[1-(1,3-thiazol-2-yl)ethylideneamino]carbamothioylamino]pentanedioate.
| Compound Name | dimethyl 2-[[1-(1,3-thiazol-2-yl)ethylideneamino]carbamothioylamino]pentanedioate |
|---|---|
| PubChem CID | 3693628 |
| Molecular Formula | C13H18N4O4S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | dimethyl 2-[[1-(1,3-thiazol-2-yl)ethylideneamino]carbamothioylamino]pentanedioate |
| SMILES | COC(=O)CCC(NC(=S)NN=C(C)c1nccs1)C(=O)OC |
| InChI | InChI=1S/C13H18N4O4S2/c1-8(11-14-6-7-23-11)16-17-13(22)15-9(12(19)21-3)4-5-10(18)20-2/h6-7,9H,4-5H2,1-3H3,(H2,15,17,22) |
| InChIKey | WTYFQCKQWGBDMD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|