C6H8N2S2 — CID 18721450
methyl N-methyl-1,3-thiazole-2-carboximidothioate (PubChem CID 18721450) has the molecular formula C6H8N2S2 and a molecular weight of 172.28 g/mol. Its IUPAC name is methyl N-methyl-1,3-thiazole-2-carboximidothioate.
| Compound Name | methyl N-methyl-1,3-thiazole-2-carboximidothioate |
|---|---|
| PubChem CID | 18721450 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | methyl N-methyl-1,3-thiazole-2-carboximidothioate |
| SMILES | C/N=C(\SC)c1nccs1 |
| InChI | InChI=1S/C6H8N2S2/c1-7-5(9-2)6-8-3-4-10-6/h3-4H,1-2H3/b7-5- |
| InChIKey | SWQWJKCXVWGEGA-ALCCZGGFSA-N |
| XLogP | 1.88 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|