C14H22N2O2S — CID 156776974
(NZ,S)-2-methyl-N-[1-(6-propan-2-yloxy-3-pyridinyl)ethylidene]propane-2-sulfinamide (PubChem CID 156776974) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is (NZ,S)-2-methyl-N-[1-(6-propan-2-yloxy-3-pyridinyl)ethylidene]propane-2-sulfinamide.
| Compound Name | (NZ,S)-2-methyl-N-[1-(6-propan-2-yloxy-3-pyridinyl)ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 156776974 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (NZ,S)-2-methyl-N-[1-(6-propan-2-yloxy-3-pyridinyl)ethylidene]propane-2-sulfinamide |
| SMILES | C/C(=N/[S@@](=O)C(C)(C)C)c1ccc(OC(C)C)nc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-10(2)18-13-8-7-12(9-15-13)11(3)16-19(17)14(4,5)6/h7-10H,1-6H3/b16-11-/t19-/m0/s1 |
| InChIKey | TXVJYKASNRCCMS-QMDZLVRISA-N |
| XLogP | 3.14 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|