C12H17BrN2OS — CID 59278489
(NE,R)-N-[1-(6-bromo-3-pyridinyl)propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 59278489) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is (NE,R)-N-[1-(6-bromo-3-pyridinyl)propylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-(6-bromo-3-pyridinyl)propylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 59278489 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (NE,R)-N-[1-(6-bromo-3-pyridinyl)propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC/C(=N\[S@](=O)C(C)(C)C)c1ccc(Br)nc1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-5-10(15-17(16)12(2,3)4)9-6-7-11(13)14-8-9/h6-8H,5H2,1-4H3/b15-10+/t17-/m1/s1 |
| InChIKey | XUQWKILIYYEYSS-IUYQLWOBSA-N |
| XLogP | 3.51 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|