C13H17N3OS — CID 87212835
(NE,S)-N-[1-(1H-indazol-5-yl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 87212835) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is (NE,S)-N-[1-(1H-indazol-5-yl)ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[1-(1H-indazol-5-yl)ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 87212835 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (NE,S)-N-[1-(1H-indazol-5-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@@](=O)C(C)(C)C)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C13H17N3OS/c1-9(16-18(17)13(2,3)4)10-5-6-12-11(7-10)8-14-15-12/h5-8H,1-4H3,(H,14,15)/b16-9+/t18-/m0/s1 |
| InChIKey | LTWHGFBGIFBMLF-WBNHJWIASA-N |
| XLogP | 2.83 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|