C15H19N3O3 — CID 80999514
tert-butyl (2R)-2-(1H-indazole-5-carbonylamino)propanoate (PubChem CID 80999514) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-(1H-indazole-5-carbonylamino)propanoate.
| Compound Name | tert-butyl (2R)-2-(1H-indazole-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 80999514 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | tert-butyl (2R)-2-(1H-indazole-5-carbonylamino)propanoate |
| SMILES | C[C@@H](NC(=O)c1ccc2[nH]ncc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19N3O3/c1-9(14(20)21-15(2,3)4)17-13(19)10-5-6-12-11(7-10)8-16-18-12/h5-9H,1-4H3,(H,16,18)(H,17,19)/t9-/m1/s1 |
| InChIKey | DKJYBCGFGYYYIB-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |