C19H19N3O3 — CID 119042310
methyl 3-(1H-indazole-5-carbonylamino)-2-methyl-3-phenylpropanoate (PubChem CID 119042310) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 3-(1H-indazole-5-carbonylamino)-2-methyl-3-phenylpropanoate.
| Compound Name | methyl 3-(1H-indazole-5-carbonylamino)-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 119042310 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methyl 3-(1H-indazole-5-carbonylamino)-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)C(C)C(NC(=O)c1ccc2[nH]ncc2c1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3/c1-12(19(24)25-2)17(13-6-4-3-5-7-13)21-18(23)14-8-9-16-15(10-14)11-20-22-16/h3-12,17H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HJIUTRPNOQMQLQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |