About methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate
methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate (PubChem CID 59252820) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate |
| PubChem CID | 59252820 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate |
| SMILES | COC(=O)C(c1ccccc1)C(c1ccccc1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C23H20N2O2/c1-27-23(26)22(17-10-6-3-7-11-17)21(16-8-4-2-5-9-16)18-12-13-20-19(14-18)15-24-25-20/h2-15,21-22H,1H3,(H,24,25) |
| InChIKey | SYCCDHLLSNYTHP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate?
The IUPAC name of methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate (CID 59252820) is methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate.
What is the SMILES notation for methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate?
The canonical SMILES for methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate is COC(=O)C(c1ccccc1)C(c1ccccc1)c1ccc2[nH]ncc2c1.
What is the InChIKey of methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate?
The InChIKey is SYCCDHLLSNYTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O2/c1-27-23(26)22(17-10-6-3-7-11-17)21(16-8-4-2-5-9-16)18-12-13-20-19(14-18)15-24-25-20/h2-15,21-22H,1H3,(H,24,25).
What are the key properties of methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate?
methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate has a molecular weight of 356.43 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate is sourced from PubChem (CID 59252820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).