C23H20N2O2 — CID 59252820
methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate (PubChem CID 59252820) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate.
| Compound Name | methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 59252820 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl 3-(1H-indazol-5-yl)-2,3-diphenylpropanoate |
| SMILES | COC(=O)C(c1ccccc1)C(c1ccccc1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C23H20N2O2/c1-27-23(26)22(17-10-6-3-7-11-17)21(16-8-4-2-5-9-16)18-12-13-20-19(14-18)15-24-25-20/h2-15,21-22H,1H3,(H,24,25) |
| InChIKey | SYCCDHLLSNYTHP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |