C29H50BrFN4O4S2Si — CID 131747231
(R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1-[S-(2-cyanopropan-2-yl)-N-[2-(oxan-2-yloxy)ethyl]sulfonimidoyl]propan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 131747231) has the molecular formula C29H50BrFN4O4S2Si and a molecular weight of 709.86 g/mol. Its IUPAC name is (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1-[S-(2-cyanopropan-2-yl)-N-[2-(oxan-2-yloxy)ethyl]sulfonimidoyl]propan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1-[S-(2-cyanopropan-2-yl)-N-[2-(oxan-2-yloxy)ethyl]sulfonimidoyl]propan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 131747231 |
| Molecular Formula | C29H50BrFN4O4S2Si |
| Molecular Weight | 709.86 g/mol |
| Exact Mass | 708.22 |
| IUPAC Name | (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-1-[S-(2-cyanopropan-2-yl)-N-[2-(oxan-2-yloxy)ethyl]sulfonimidoyl]propan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[Si](CC)(CC)c1cc(Br)nc([C@](C)(CS(=O)(=NCCOC2CCCCO2)C(C)(C)C#N)N[S@](=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C29H50BrFN4O4S2Si/c1-10-42(11-2,12-3)22-19-23(30)34-26(25(22)31)29(9,35-40(36)27(4,5)6)21-41(37,28(7,8)20-32)33-16-18-39-24-15-13-14-17-38-24/h19,24,35H,10-18,21H2,1-9H3/t24?,29-,40+,41?/m0/s1 |
| InChIKey | BAEFKGIXIKYGNF-FKUAKTALSA-N |
| XLogP | 6.28 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.86 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|