C16H23NO3S — CID 166663409
[4-cyclopropyl-2-(oxan-2-yloxymethyl)phenyl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 166663409) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is [4-cyclopropyl-2-(oxan-2-yloxymethyl)phenyl]-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [4-cyclopropyl-2-(oxan-2-yloxymethyl)phenyl]-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166663409 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [4-cyclopropyl-2-(oxan-2-yloxymethyl)phenyl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1ccc(C2CC2)cc1COC1CCCCO1 |
| InChI | InChI=1S/C16H23NO3S/c1-21(17,18)15-8-7-13(12-5-6-12)10-14(15)11-20-16-4-2-3-9-19-16/h7-8,10,12,16-17H,2-6,9,11H2,1H3 |
| InChIKey | KQUGSHWHLXFWBC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |