C24H42BNO6SSi — CID 170600981
N-[tert-butyl(dimethyl)silyl]-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 170600981) has the molecular formula C24H42BNO6SSi and a molecular weight of 511.57 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 170600981 |
| Molecular Formula | C24H42BNO6SSi |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-3-(oxan-2-yloxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)N[Si](C)(C)C(C)(C)C)cc2COC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C24H42BNO6SSi/c1-22(2,3)34(8,9)26-33(27,28)19-13-14-20(25-31-23(4,5)24(6,7)32-25)18(16-19)17-30-21-12-10-11-15-29-21/h13-14,16,21,26H,10-12,15,17H2,1-9H3 |
| InChIKey | CZWWYKNYGPIKMX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|