C14H18BFO4 — CID 24965213
2-[4-fluoro-2-(oxan-2-yloxymethyl)phenyl]-1,3,2-dioxaborolane (PubChem CID 24965213) has the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. Its IUPAC name is 2-[4-fluoro-2-(oxan-2-yloxymethyl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 2-[4-fluoro-2-(oxan-2-yloxymethyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 24965213 |
| Molecular Formula | C14H18BFO4 |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[4-fluoro-2-(oxan-2-yloxymethyl)phenyl]-1,3,2-dioxaborolane |
| SMILES | Fc1ccc(B2OCCO2)c(COC2CCCCO2)c1 |
| InChI | InChI=1S/C14H18BFO4/c16-12-4-5-13(15-19-7-8-20-15)11(9-12)10-18-14-3-1-2-6-17-14/h4-5,9,14H,1-3,6-8,10H2 |
| InChIKey | OITVWWCIORLEDU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|