C20H28BNO5 — CID 125499694
6-methoxy-3-[[(2S)-oxan-2-yl]oxymethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 125499694) has the molecular formula C20H28BNO5 and a molecular weight of 373.26 g/mol. Its IUPAC name is 6-methoxy-3-[[(2S)-oxan-2-yl]oxymethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 6-methoxy-3-[[(2S)-oxan-2-yl]oxymethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 125499694 |
| Molecular Formula | C20H28BNO5 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 6-methoxy-3-[[(2S)-oxan-2-yl]oxymethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | COc1ccc(CO[C@H]2CCCCO2)c(B2OC(C)(C)C(C)(C)O2)c1C#N |
| InChI | InChI=1S/C20H28BNO5/c1-19(2)20(3,4)27-21(26-19)18-14(9-10-16(23-5)15(18)12-22)13-25-17-8-6-7-11-24-17/h9-10,17H,6-8,11,13H2,1-5H3/t17-/m0/s1 |
| InChIKey | APFGNUVXHBJZIV-KRWDZBQOSA-N |
| XLogP | 2.91 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|