C16H17F2N5O3 — CID 166873863
6-[4-ethyl-3-(oxan-2-yloxymethyl)-5-oxo-1,2,4-triazol-1-yl]-2,5-difluoropyridine-3-carbonitrile (PubChem CID 166873863) has the molecular formula C16H17F2N5O3 and a molecular weight of 365.34 g/mol. Its IUPAC name is 6-[4-ethyl-3-(oxan-2-yloxymethyl)-5-oxo-1,2,4-triazol-1-yl]-2,5-difluoropyridine-3-carbonitrile.
| Compound Name | 6-[4-ethyl-3-(oxan-2-yloxymethyl)-5-oxo-1,2,4-triazol-1-yl]-2,5-difluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166873863 |
| Molecular Formula | C16H17F2N5O3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 6-[4-ethyl-3-(oxan-2-yloxymethyl)-5-oxo-1,2,4-triazol-1-yl]-2,5-difluoropyridine-3-carbonitrile |
| SMILES | CCn1c(COC2CCCCO2)nn(-c2nc(F)c(C#N)cc2F)c1=O |
| InChI | InChI=1S/C16H17F2N5O3/c1-2-22-12(9-26-13-5-3-4-6-25-13)21-23(16(22)24)15-11(17)7-10(8-19)14(18)20-15/h7,13H,2-6,9H2,1H3 |
| InChIKey | OXLIUQNIXBKUFV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|