C18H27ClFNO3S — CID 90375567
tert-butyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-chloro-2-fluorophenyl)butanoate (PubChem CID 90375567) has the molecular formula C18H27ClFNO3S and a molecular weight of 391.94 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-chloro-2-fluorophenyl)butanoate.
| Compound Name | tert-butyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-chloro-2-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 90375567 |
| Molecular Formula | C18H27ClFNO3S |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | tert-butyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-chloro-2-fluorophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@](C)(N[S@](=O)C(C)(C)C)c1cccc(Cl)c1F |
| InChI | InChI=1S/C18H27ClFNO3S/c1-16(2,3)24-14(22)11-18(7,21-25(23)17(4,5)6)12-9-8-10-13(19)15(12)20/h8-10,21H,11H2,1-7H3/t18-,25+/m0/s1 |
| InChIKey | WNSIQDOWHSEHIJ-AVRWGWEMSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |