C11H23NO3S — CID 53487571
(3R)-3-(tert-butylsulfinylamino)-3,4-dimethylpentanoic acid (PubChem CID 53487571) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is (3R)-3-(tert-butylsulfinylamino)-3,4-dimethylpentanoic acid.
| Compound Name | (3R)-3-(tert-butylsulfinylamino)-3,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 53487571 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3R)-3-(tert-butylsulfinylamino)-3,4-dimethylpentanoic acid |
| SMILES | CC(C)[C@@](C)(CC(=O)O)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-8(2)11(6,7-9(13)14)12-16(15)10(3,4)5/h8,12H,7H2,1-6H3,(H,13,14)/t11-,16?/m1/s1 |
| InChIKey | IFTRNMSBUQSSLO-ZVDHGWRTSA-N |
| XLogP | 1.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |