C11H21NO3 — CID 153423259
(3S)-3,5-dimethyl-4-oxo-3-(propan-2-ylamino)hexanoic acid (PubChem CID 153423259) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-4-oxo-3-(propan-2-ylamino)hexanoic acid.
| Compound Name | (3S)-3,5-dimethyl-4-oxo-3-(propan-2-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 153423259 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3S)-3,5-dimethyl-4-oxo-3-(propan-2-ylamino)hexanoic acid |
| SMILES | CC(C)N[C@@](C)(CC(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C11H21NO3/c1-7(2)10(15)11(5,6-9(13)14)12-8(3)4/h7-8,12H,6H2,1-5H3,(H,13,14)/t11-/m0/s1 |
| InChIKey | CSCOZVHQLWBHIM-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |