C14H19F2NO3S — CID 126569884
(3S)-3-(tert-butylsulfinylamino)-4-fluoro-3-(2-fluorophenyl)butanoic acid (PubChem CID 126569884) has the molecular formula C14H19F2NO3S and a molecular weight of 319.37 g/mol. Its IUPAC name is (3S)-3-(tert-butylsulfinylamino)-4-fluoro-3-(2-fluorophenyl)butanoic acid.
| Compound Name | (3S)-3-(tert-butylsulfinylamino)-4-fluoro-3-(2-fluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 126569884 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (3S)-3-(tert-butylsulfinylamino)-4-fluoro-3-(2-fluorophenyl)butanoic acid |
| SMILES | CC(C)(C)S(=O)N[C@@](CF)(CC(=O)O)c1ccccc1F |
| InChI | InChI=1S/C14H19F2NO3S/c1-13(2,3)21(20)17-14(9-15,8-12(18)19)10-6-4-5-7-11(10)16/h4-7,17H,8-9H2,1-3H3,(H,18,19)/t14-,21?/m1/s1 |
| InChIKey | UIBQOMGYMVNJTG-CKAQCJTGSA-N |
| XLogP | 2.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |