C17H23F6N3OS — CID 86732220
(R)-N-[(4E)-2-(2,3-difluorophenyl)-4-(dimethylhydrazinylidene)-1,5,5,5-tetrafluoropentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 86732220) has the molecular formula C17H23F6N3OS and a molecular weight of 431.45 g/mol. Its IUPAC name is (R)-N-[(4E)-2-(2,3-difluorophenyl)-4-(dimethylhydrazinylidene)-1,5,5,5-tetrafluoropentan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(4E)-2-(2,3-difluorophenyl)-4-(dimethylhydrazinylidene)-1,5,5,5-tetrafluoropentan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86732220 |
| Molecular Formula | C17H23F6N3OS |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (R)-N-[(4E)-2-(2,3-difluorophenyl)-4-(dimethylhydrazinylidene)-1,5,5,5-tetrafluoropentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CN(C)/N=C(\CC(CF)(N[S@](=O)C(C)(C)C)c1cccc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C17H23F6N3OS/c1-15(2,3)28(27)25-16(10-18,11-7-6-8-12(19)14(11)20)9-13(17(21,22)23)24-26(4)5/h6-8,25H,9-10H2,1-5H3/b24-13+/t16?,28-/m1/s1 |
| InChIKey | DOMAEUAPMZIXDO-BXSBKLNFSA-N |
| XLogP | 4.05 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|