C14H17F4NO2S — CID 121334358
2-methyl-N-[1,3,3-trifluoro-2-(2-fluorophenyl)-4-oxobutan-2-yl]propane-2-sulfinamide (PubChem CID 121334358) has the molecular formula C14H17F4NO2S and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-methyl-N-[1,3,3-trifluoro-2-(2-fluorophenyl)-4-oxobutan-2-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[1,3,3-trifluoro-2-(2-fluorophenyl)-4-oxobutan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 121334358 |
| Molecular Formula | C14H17F4NO2S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-methyl-N-[1,3,3-trifluoro-2-(2-fluorophenyl)-4-oxobutan-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CF)(c1ccccc1F)C(F)(F)C=O |
| InChI | InChI=1S/C14H17F4NO2S/c1-12(2,3)22(21)19-13(8-15,14(17,18)9-20)10-6-4-5-7-11(10)16/h4-7,9,19H,8H2,1-3H3 |
| InChIKey | UKIHGPSECKMEDI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|