C15H22FNO3S — CID 90147603
(R)-N-[(2R,3R)-2-(2-fluorophenyl)-3-methoxy-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 90147603) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is (R)-N-[(2R,3R)-2-(2-fluorophenyl)-3-methoxy-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2R,3R)-2-(2-fluorophenyl)-3-methoxy-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90147603 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (R)-N-[(2R,3R)-2-(2-fluorophenyl)-3-methoxy-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CO[C@@H](C=O)[C@](C)(N[S@](=O)C(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C15H22FNO3S/c1-14(2,3)21(19)17-15(4,13(10-18)20-5)11-8-6-7-9-12(11)16/h6-10,13,17H,1-5H3/t13-,15+,21+/m0/s1 |
| InChIKey | COHXFEWIMCPNCM-QDUSTFBWSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|