C15H22FNO2S — CID 126733747
N-[(2S)-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 126733747) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is N-[(2S)-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2S)-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 126733747 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[(2S)-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C=O)[C@](C)(NS(=O)C(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C15H22FNO2S/c1-11(10-18)15(5,17-20(19)14(2,3)4)12-8-6-7-9-13(12)16/h6-11,17H,1-5H3/t11?,15-,20?/m0/s1 |
| InChIKey | HCMHRGXMYZGKCF-XGRGOYMPSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|