C14H22FNO2S — CID 123856021
(R)-N-[(2S)-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 123856021) has the molecular formula C14H22FNO2S and a molecular weight of 287.40 g/mol. Its IUPAC name is (R)-N-[(2S)-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2S)-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123856021 |
| Molecular Formula | C14H22FNO2S |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (R)-N-[(2S)-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@](C)(CCO)c1ccccc1F |
| InChI | InChI=1S/C14H22FNO2S/c1-13(2,3)19(18)16-14(4,9-10-17)11-7-5-6-8-12(11)15/h5-8,16-17H,9-10H2,1-4H3/t14-,19+/m0/s1 |
| InChIKey | OIMDPNHRQALRBZ-IFXJQAMLSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |