C15H21F2NO2S — CID 90302994
N-[(2R,3R)-3-fluoro-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 90302994) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[(2R,3R)-3-fluoro-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2R,3R)-3-fluoro-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90302994 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[(2R,3R)-3-fluoro-2-(2-fluorophenyl)-3-methyl-4-oxobutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@](C)(c1ccccc1F)[C@@](C)(F)C=O |
| InChI | InChI=1S/C15H21F2NO2S/c1-13(2,3)21(20)18-15(5,14(4,17)10-19)11-8-6-7-9-12(11)16/h6-10,18H,1-5H3/t14-,15+,21?/m0/s1 |
| InChIKey | QFCXBMGFPPJYKA-ZOMUKPOZSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|