C13H26O2Y — CID 161151978
3,4,5,5-tetramethyl-3-propan-2-ylhexanoic acid;yttrium (PubChem CID 161151978) has the molecular formula C13H26O2Y and a molecular weight of 303.26 g/mol. Its IUPAC name is 3,4,5,5-tetramethyl-3-propan-2-ylhexanoic acid;yttrium.
| Compound Name | 3,4,5,5-tetramethyl-3-propan-2-ylhexanoic acid;yttrium |
|---|---|
| PubChem CID | 161151978 |
| Molecular Formula | C13H26O2Y |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3,4,5,5-tetramethyl-3-propan-2-ylhexanoic acid;yttrium |
| SMILES | CC(C)C(C)(CC(=O)O)C(C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C13H26O2.Y/c1-9(2)13(7,8-11(14)15)10(3)12(4,5)6;/h9-10H,8H2,1-7H3,(H,14,15); |
| InChIKey | UOUMGYZZMBALOO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |