C14H29NO3S — CID 87760260
methyl (3S,5S)-3-(tert-butylsulfinylamino)-3,5-dimethylheptanoate (PubChem CID 87760260) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is methyl (3S,5S)-3-(tert-butylsulfinylamino)-3,5-dimethylheptanoate.
| Compound Name | methyl (3S,5S)-3-(tert-butylsulfinylamino)-3,5-dimethylheptanoate |
|---|---|
| PubChem CID | 87760260 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | methyl (3S,5S)-3-(tert-butylsulfinylamino)-3,5-dimethylheptanoate |
| SMILES | CC[C@H](C)C[C@@](C)(CC(=O)OC)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO3S/c1-8-11(2)9-14(6,10-12(16)18-7)15-19(17)13(3,4)5/h11,15H,8-10H2,1-7H3/t11-,14-,19?/m0/s1 |
| InChIKey | WZXJWYBQWAJHDP-DVKJCAQOSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |