C18H27NO3S — CID 91219816
methyl 2-[[(R)-tert-butylsulfinyl]amino]-2-ethyl-4-phenylpent-4-enoate (PubChem CID 91219816) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is methyl 2-[[(R)-tert-butylsulfinyl]amino]-2-ethyl-4-phenylpent-4-enoate.
| Compound Name | methyl 2-[[(R)-tert-butylsulfinyl]amino]-2-ethyl-4-phenylpent-4-enoate |
|---|---|
| PubChem CID | 91219816 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl 2-[[(R)-tert-butylsulfinyl]amino]-2-ethyl-4-phenylpent-4-enoate |
| SMILES | C=C(CC(CC)(N[S@](=O)C(C)(C)C)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C18H27NO3S/c1-7-18(16(20)22-6,19-23(21)17(3,4)5)13-14(2)15-11-9-8-10-12-15/h8-12,19H,2,7,13H2,1,3-6H3/t18?,23-/m1/s1 |
| InChIKey | WAZFZORMMPRLIN-WBPHRXDCSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |