C14H27NOS — CID 101415067
N-[(3S)-2,3-dimethyloct-4-yn-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 101415067) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is N-[(3S)-2,3-dimethyloct-4-yn-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(3S)-2,3-dimethyloct-4-yn-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 101415067 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N-[(3S)-2,3-dimethyloct-4-yn-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CCCC#C[C@@](C)(NS(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H27NOS/c1-8-9-10-11-14(7,12(2)3)15-17(16)13(4,5)6/h12,15H,8-9H2,1-7H3/t14-,17?/m1/s1 |
| InChIKey | MEPWVFLDUMLDKZ-XPCCGILXSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|