C15H32O7P2 — CID 135001316
4,4-bis(diethoxyphosphoryl)-2-propan-2-ylbutanal (PubChem CID 135001316) has the molecular formula C15H32O7P2 and a molecular weight of 386.36 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)-2-propan-2-ylbutanal.
| Compound Name | 4,4-bis(diethoxyphosphoryl)-2-propan-2-ylbutanal |
|---|---|
| PubChem CID | 135001316 |
| Molecular Formula | C15H32O7P2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)-2-propan-2-ylbutanal |
| SMILES | CCOP(=O)(OCC)C(CC(C=O)C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H32O7P2/c1-7-19-23(17,20-8-2)15(11-14(12-16)13(5)6)24(18,21-9-3)22-10-4/h12-15H,7-11H2,1-6H3 |
| InChIKey | SQGQMHZTEIHDSY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|