C12H24NO7P — CID 174603577
2-amino-2-(diethoxyphosphorylmethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 174603577) has the molecular formula C12H24NO7P and a molecular weight of 325.30 g/mol. Its IUPAC name is 2-amino-2-(diethoxyphosphorylmethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | 2-amino-2-(diethoxyphosphorylmethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 174603577 |
| Molecular Formula | C12H24NO7P |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-amino-2-(diethoxyphosphorylmethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CCOP(=O)(CC(N)(C(=O)O)C(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C12H24NO7P/c1-6-18-21(17,19-7-2)8-12(13,9(14)15)10(16)20-11(3,4)5/h6-8,13H2,1-5H3,(H,14,15) |
| InChIKey | HTNYQKMWYIQKSY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|