C12H21O7P — CID 54152263
4-(1-diethoxyphosphoryl-2-methylpropan-2-yl)oxy-4-oxobut-2-enoic acid (PubChem CID 54152263) has the molecular formula C12H21O7P and a molecular weight of 308.27 g/mol. Its IUPAC name is 4-(1-diethoxyphosphoryl-2-methylpropan-2-yl)oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-(1-diethoxyphosphoryl-2-methylpropan-2-yl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54152263 |
| Molecular Formula | C12H21O7P |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-(1-diethoxyphosphoryl-2-methylpropan-2-yl)oxy-4-oxobut-2-enoic acid |
| SMILES | CCOP(=O)(CC(C)(C)OC(=O)C=CC(=O)O)OCC |
| InChI | InChI=1S/C12H21O7P/c1-5-17-20(16,18-6-2)9-12(3,4)19-11(15)8-7-10(13)14/h7-8H,5-6,9H2,1-4H3,(H,13,14) |
| InChIKey | OIODRSJCHCCXIO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|