C11H15ClF3NO — CID 167530945
1-[2-methoxy-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (PubChem CID 167530945) has the molecular formula C11H15ClF3NO and a molecular weight of 269.69 g/mol. Its IUPAC name is 1-[2-methoxy-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | 1-[2-methoxy-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 167530945 |
| Molecular Formula | C11H15ClF3NO |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[2-methoxy-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| SMILES | CCC(N)c1ccc(C(F)(F)F)cc1OC.Cl |
| InChI | InChI=1S/C11H14F3NO.ClH/c1-3-9(15)8-5-4-7(11(12,13)14)6-10(8)16-2;/h4-6,9H,3,15H2,1-2H3;1H |
| InChIKey | PWNNAUPZNNAEAD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |