C10H13ClF3NO2 — CID 155973060
2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]ethanol;hydrochloride (PubChem CID 155973060) has the molecular formula C10H13ClF3NO2 and a molecular weight of 271.67 g/mol. Its IUPAC name is 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]ethanol;hydrochloride.
| Compound Name | 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 155973060 |
| Molecular Formula | C10H13ClF3NO2 |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]ethanol;hydrochloride |
| SMILES | COc1cc(C(F)(F)F)ccc1C(O)CN.Cl |
| InChI | InChI=1S/C10H12F3NO2.ClH/c1-16-9-4-6(10(11,12)13)2-3-7(9)8(15)5-14;/h2-4,8,15H,5,14H2,1H3;1H |
| InChIKey | XLDUJDBSHFUJMM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |