C13H19F3N2O2 — CID 83921398
2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-(methylamino)butan-1-ol (PubChem CID 83921398) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-(methylamino)butan-1-ol.
| Compound Name | 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 83921398 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-amino-1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-(methylamino)butan-1-ol |
| SMILES | CNCCC(N)C(O)c1ccc(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C13H19F3N2O2/c1-18-6-5-10(17)12(19)9-4-3-8(13(14,15)16)7-11(9)20-2/h3-4,7,10,12,18-19H,5-6,17H2,1-2H3 |
| InChIKey | GFUQFFIRDMQSRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |