C13H21BrNO5P — CID 171191976
(S)-(4-bromo-2,5-dimethoxyphenyl)-diethoxyphosphorylmethanamine (PubChem CID 171191976) has the molecular formula C13H21BrNO5P and a molecular weight of 382.19 g/mol. Its IUPAC name is (S)-(4-bromo-2,5-dimethoxyphenyl)-diethoxyphosphorylmethanamine.
| Compound Name | (S)-(4-bromo-2,5-dimethoxyphenyl)-diethoxyphosphorylmethanamine |
|---|---|
| PubChem CID | 171191976 |
| Molecular Formula | C13H21BrNO5P |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (S)-(4-bromo-2,5-dimethoxyphenyl)-diethoxyphosphorylmethanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C13H21BrNO5P/c1-5-19-21(16,20-6-2)13(15)9-7-12(18-4)10(14)8-11(9)17-3/h7-8,13H,5-6,15H2,1-4H3/t13-/m0/s1 |
| InChIKey | XZOKISZXHXXAJT-ZDUSSCGKSA-N |
| XLogP | 3.69 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|